Molecular Definition

Canonical SMILES CN(CCc1c[nH]c2c1cc(C[C@H]1COC(=O)N1)cc2)C
Formula C16H21N3O2
Molecular Weight 287.36 da
Stereocenters 1/1