Molecular Definition

Canonical SMILES [H][C@]12CC[C@]([H])(C[C@@H](C1)OC(=O)C(O)(C1=CC=CC=C1)C1=CC=CC=C1)[N+]21CCCC1
Formula C25H30NO3
Molecular Weight 392.51 da
Stereocenters 3/4