Molecular Definition

Canonical SMILES O=C1N(CC2=CC=CC=C2)C2C[S+]3CCCC3C2N1CC1=CC=CC=C1
Formula C22H25N2OS
Molecular Weight 365.51 da
Stereocenters 0/4