Target Relevance

Molecular Definition

Canonical SMILES CN(C)S(=O)(=O)C1=CC2=C(SC3=CC=CC=C3\C2=C\CCN2CCN(C)CC2)C=C1
Formula C23H29N3O2S2
Molecular Weight 443.63 da
Stereocenters 0/0