Molecular Definition

Canonical SMILES [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C
Formula C19H28O2
Molecular Weight 288.42 da
Stereocenters 6/6