Molecular Definition

Canonical SMILES COC1=CC2=C(C=C1OC)C(N)=NC(=N2)N1CCN(CC1)C(=O)C1CCCO1
Formula C19H25N5O4
Molecular Weight 387.43 da
Stereocenters 0/1