Molecular Definition

Canonical SMILES CCOC(=O)C1=CN=C(C=C1)C#CC1=CC=C2SCCC(C)(C)C2=C1
Formula C21H21NO2S
Molecular Weight 351.46 da
Stereocenters 0/0