Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]1(CNC(=O)CC)C[C@@]1([H])C1=C2CCOC2=CC=C1
Formula C15H19NO2
Molecular Weight 245.32 da
Stereocenters 2/2