Molecular Definition

Canonical SMILES CC(=O)S[C@@H]1CC2=CC(=O)CC[C@]2(C)[C@H]3CC[C@@]4(C)[C@@H](CC[C@@]45CCC(=O)O5)[C@H]13
Formula C24H32O4S
Molecular Weight 416.57 da
Stereocenters 7/7