Molecular Definition

Canonical SMILES CC1N(CCC2=CC=CC=C12)C1=C(C)C(C)=NC(NC2=CC=C(F)C=C2)=N1
Formula C22H23FN4
Molecular Weight 362.44 da
Stereocenters 0/1