Molecular Definition

Canonical SMILES CCOC(=O)NC1=C(N)C=C(NCC2=CC=C(F)C=C2)C=C1
Formula C16H18FN3O2
Molecular Weight 303.33 da
Stereocenters 0/0