Molecular Definition

Canonical SMILES COc1cc(ccc1O)CC(=O)OCC1=C[C@H]2[C@H]3O[C@]4(O[C@]2([C@H]2[C@@](C1)(O)C(=O)C(=C2)C)[C@@H](C[C@@]3(O4)C(=C)C)C)Cc1ccccc1
Formula C37H40O9
Molecular Weight 628.71 da
Stereocenters 8/8