Molecular Definition

Canonical SMILES CC1=C(CCNCC2=CC=C(\C=C\C(=O)NO)C=C2)C2=CC=CC=C2N1
Formula C21H23N3O2
Molecular Weight 349.43 da
Stereocenters 0/0