Molecular Definition

Canonical SMILES NCCC(O)(P(O)(O)=O)P(O)(O)=O
Formula C3H11NO7P2
Molecular Weight 235.07 da
Stereocenters 0/0