Target Relevance

Molecular Definition

Canonical SMILES [H]N[C@H]1CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](CC2=CC=C(O)C=C2)NC1=O)[C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O
Formula C43H66N12O12S2
Molecular Weight 1007.19 da
Stereocenters 9/9