Molecular Definition

Canonical SMILES OC(COc1cccc2c1C[C@H](O)[C@@H](C2)O)CNC(C)(C)C
Formula C17H27NO4
Molecular Weight 309.40 da
Stereocenters 2/3