Molecular Definition

Canonical SMILES CC1=CC=CC(CN2CCN(CC2)C(C2=CC=CC=C2)C2=CC=C(Cl)C=C2)=C1
Formula C25H27ClN2
Molecular Weight 390.95 da
Stereocenters 0/1