Molecular Definition

Canonical SMILES [H]C12CCC([H])(C1)C(C)(NC)C2(C)C
Formula C11H21N
Molecular Weight 167.29 da
Stereocenters 0/3