Molecular Definition

Canonical SMILES C[C@@H](CC1=CC(O)=C(O)C=C1)[C@H](C)CC1=CC(O)=C(O)C=C1
Formula C18H22O4
Molecular Weight 302.36 da
Stereocenters 2/2