Molecular Definition

Canonical SMILES CN1CCC(=C2c3ccccc3CC(=O)c4sccc24)CC1
Formula C19H19NOS
Molecular Weight 309.43 da
Stereocenters 0/0