Molecular Definition

Canonical SMILES CCC(C)N1N=CN(C1=O)C1=CC=C(C=C1)N1CCN(CC1)C1=CC=C(OCC2COC(CN3C=NC=N3)(O2)C2=C(Cl)C=C(Cl)C=C2)C=C1
Formula C35H38Cl2N8O4
Molecular Weight 705.63 da
Stereocenters 0/3