Target Relevance

Molecular Definition

Canonical SMILES CCN(CCO)CCCC(C)NC1=CC=NC2=CC(Cl)=CC=C12
Formula C18H26ClN3O
Molecular Weight 335.87 da
Stereocenters 0/1