Molecular Definition

Canonical SMILES Cc1ccc(C)c(OCCCC(C)(C)C(=O)O)c1
Formula C15H22O3
Molecular Weight 250.33 da
Stereocenters 0/0