Molecular Definition

Canonical SMILES CC(C(O)=O)C1=CC(F)=C(C=C1)C1=CC=CC=C1
Formula C15H13FO2
Molecular Weight 244.26 da
Stereocenters 0/1