Molecular Definition

Canonical SMILES CC(C)N(CC[C@H](C1=CC=CC=C1)C1=C(OC(=O)C(C)C)C=CC(CO)=C1)C(C)C
Formula C26H37NO3
Molecular Weight 411.58 da
Stereocenters 1/1