Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CC[C@@H]1[C@H](N(C1=O)C1=CC=C(F)C=C1)C1=CC=C(O)C=C1)C1=CC=C(F)C=C1
Formula C24H21F2NO3
Molecular Weight 409.43 da
Stereocenters 3/3