Molecular Definition

Canonical SMILES CN1CCC[C@@H]1CC1=CNC2=C1C=C(CCS(=O)(=O)C1=CC=CC=C1)C=C2
Formula C22H26N2O2S
Molecular Weight 382.52 da
Stereocenters 1/1