Molecular Definition

Canonical SMILES CCCCOC1=CC=C(C=C1)C(=O)CCN1CCCCC1
Formula C18H27NO2
Molecular Weight 289.41 da
Stereocenters 0/0