Molecular Definition

Canonical SMILES CNCC[C@@H](c1cccs1)Oc1cccc2c1cccc2
Formula C18H19NOS
Molecular Weight 297.42 da
Stereocenters 1/1