Target Relevance

Molecular Definition

Canonical SMILES CSCCNC1=NC(SCCC(F)(F)F)=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)C(Cl)(Cl)P(O)(O)=O)[C@@H](O)[C@H]1O
Formula C17H25Cl2F3N5O12P3S2
Molecular Weight 776.36 da
Stereocenters 4/4