Molecular Definition

Canonical SMILES BrC1=C(NC2=NCCN2)C=CC2=NC=CN=C12
Formula C11H10BrN5
Molecular Weight 292.14 da
Stereocenters 0/0