Molecular Definition

Canonical SMILES NCC(CC(O)=O)C1=CC=C(Cl)C=C1
Formula C10H12ClNO2
Molecular Weight 213.66 da
Stereocenters 0/1