Molecular Definition

Canonical SMILES CCCNC(C)C(=O)NC1=C(SC=C1C)C(=O)OC
Formula C13H20N2O3S
Molecular Weight 284.37 da
Stereocenters 0/1