Molecular Definition

Canonical SMILES CC(C)C1=CC=C2OC3=C(C=C(C(O)=O)C(N)=N3)C(=O)C2=C1
Formula C16H14N2O4
Molecular Weight 298.29 da
Stereocenters 0/0