Molecular Definition

Canonical SMILES CCOc1cc(ccc1Nc1ncc2c(n1)n(C)c1ccccc1c(=O)n2C)N1CCC(CC1)O
Formula C26H30N6O3
Molecular Weight 474.55 da
Stereocenters 0/0