Synonym

Molecular Definition

Canonical SMILES CCN(S(=O)(=O)c1ccc(c(c1)NC(=O)c1[nH]c(c(c1CC)C(=O)C)C)O)CC
Formula C20H27N3O5S
Molecular Weight 421.51 da
Stereocenters 0/0