Target Relevance

Molecular Definition

Canonical SMILES OCCNS(=O)(=O)c1cc(ccc1Cl)c1sc(nc1C)NC(=O)C
Formula C14H16ClN3O4S2
Molecular Weight 389.88 da
Stereocenters 0/0