Molecular Definition

Canonical SMILES CCCCCCCc1ccc(cc1)CCc1cccc(c1C(=O)O)O
Formula C22H28O3
Molecular Weight 340.46 da
Stereocenters 0/0