Target Relevance

Molecular Definition

Canonical SMILES O=C(OCc1ccc(cc1)[N+](=O)[O-])NCCCCC(C(=O)[O-])NC(=O)C(CCCCNC(=O)Oc1ccc(cc1)[N+](=O)[O-])[NH3+]
Formula C27H34N6O11
Molecular Weight 618.59 da
Stereocenters 0/2