Molecular Definition

Canonical SMILES C([3H])C(c1ccc(cc1)C(=O)Nc1cccc(c1)CO[C@@H]([C@@H](C(=O)O)N)C(=O)O)[3H]
Formula C20H22N2O6
Molecular Weight 390.41 da
Stereocenters 2/3