Molecular Definition

Canonical SMILES OC(=O)CCNc1nc(nc(c1)N1CCc2ccccc2CC1)c1ccccn1
Formula C22H23N5O2
Molecular Weight 389.45 da
Stereocenters 0/0