Target Relevance

Molecular Definition

Canonical SMILES OC(=O)COc1cccc2C[C@@H](CN3N=C(C=CC3=O)C(c4ccccc4)c5ccccc5)CCc12
Formula C30H28N2O4
Molecular Weight 480.55 da
Stereocenters 1/1