Molecular Definition

Canonical SMILES Oc1cc2OC(=CC(=O)c2c(O)c1O)c3ccccc3
Formula C15H10O5
Molecular Weight 270.24 da
Stereocenters 0/0