Molecular Definition

Canonical SMILES OC1=C(C(C2=C(O)Oc3ccccc3C2=O)c4cccs4)C(=O)c5ccccc5O1
Formula C23H14O6S
Molecular Weight 418.42 da
Stereocenters 0/0