Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)C(CC(C)C)(Cc2cccnc2)C(=O)NO
Formula C19H24N2O5S
Molecular Weight 392.47 da
Stereocenters 0/1