Molecular Definition

Canonical SMILES COc1c(C)c(Nc2ncc[nH]2)c(C)cc1C(C)(C)C
Formula C16H23N3O
Molecular Weight 273.37 da
Stereocenters 0/0