Molecular Definition

Canonical SMILES CCN(CC)CCOCCOC(=O)C1(CCCC1)c2ccc(Cl)cc2
Formula C20H30ClNO3
Molecular Weight 367.91 da
Stereocenters 0/0