Molecular Definition

Canonical SMILES CC(C)Oc1ccccc1N2CCN(Cc3cc(CN4CCCCC4=O)cs3)CC2
Formula C24H33N3O2S
Molecular Weight 427.60 da
Stereocenters 0/0