Target Relevance

Molecular Definition

Canonical SMILES CC(C)c1nc(c2cccc(C)n2)c([nH]1)c3ccnc(c3)c4ccc(cc4)C(=O)NC5CCOCC5
Formula C29H31N5O2
Molecular Weight 481.59 da
Stereocenters 0/0