Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)NCC(=O)N4CCN(C)CC4
Formula C25H33N7O4
Molecular Weight 495.57 da
Stereocenters 0/0